C28H38ClN6O3P — CID 175210555
5-chloro-2-N-[4-[4-(dimethylamino)piperidin-1-yl]-3-(2-methoxyethoxy)phenyl]-4-N-(2-dimethylphosphorylphenyl)pyrimidine-2,4-diamine (PubChem CID 175210555) has the molecular formula C28H38ClN6O3P and a molecular weight of 573.08 g/mol. Its IUPAC name is 5-chloro-2-N-[4-[4-(dimethylamino)piperidin-1-yl]-3-(2-methoxyethoxy)phenyl]-4-N-(2-dimethylphosphorylphenyl)pyrimidine-2,4-diamine.
| Compound Name | 5-chloro-2-N-[4-[4-(dimethylamino)piperidin-1-yl]-3-(2-methoxyethoxy)phenyl]-4-N-(2-dimethylphosphorylphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 175210555 |
| Molecular Formula | C28H38ClN6O3P |
| Molecular Weight | 573.08 g/mol |
| Exact Mass | 572.24 |
| IUPAC Name | 5-chloro-2-N-[4-[4-(dimethylamino)piperidin-1-yl]-3-(2-methoxyethoxy)phenyl]-4-N-(2-dimethylphosphorylphenyl)pyrimidine-2,4-diamine |
| SMILES | COCCOc1cc(Nc2ncc(Cl)c(Nc3ccccc3P(C)(C)=O)n2)ccc1N1CCC(N(C)C)CC1 |
| InChI | InChI=1S/C28H38ClN6O3P/c1-34(2)21-12-14-35(15-13-21)24-11-10-20(18-25(24)38-17-16-37-3)31-28-30-19-22(29)27(33-28)32-23-8-6-7-9-26(23)39(4,5)36/h6-11,18-19,21H,12-17H2,1-5H3,(H2,30,31,32,33) |
| InChIKey | BUYMMTKMPLDPPE-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 91.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.08 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|