C32H43ClN7O3P — CID 175211970
5-chloro-4-N-(2-dimethylphosphorylphenyl)-2-N-[4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]-3-(oxolan-3-yloxy)phenyl]pyrimidine-2,4-diamine (PubChem CID 175211970) has the molecular formula C32H43ClN7O3P and a molecular weight of 640.17 g/mol. Its IUPAC name is 5-chloro-4-N-(2-dimethylphosphorylphenyl)-2-N-[4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]-3-(oxolan-3-yloxy)phenyl]pyrimidine-2,4-diamine.
| Compound Name | 5-chloro-4-N-(2-dimethylphosphorylphenyl)-2-N-[4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]-3-(oxolan-3-yloxy)phenyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 175211970 |
| Molecular Formula | C32H43ClN7O3P |
| Molecular Weight | 640.17 g/mol |
| Exact Mass | 639.29 |
| IUPAC Name | 5-chloro-4-N-(2-dimethylphosphorylphenyl)-2-N-[4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]-3-(oxolan-3-yloxy)phenyl]pyrimidine-2,4-diamine |
| SMILES | CN1CCN(C2CCN(c3ccc(Nc4ncc(Cl)c(Nc5ccccc5P(C)(C)=O)n4)cc3OC3CCOC3)CC2)CC1 |
| InChI | InChI=1S/C32H43ClN7O3P/c1-38-15-17-39(18-16-38)24-10-13-40(14-11-24)28-9-8-23(20-29(28)43-25-12-19-42-22-25)35-32-34-21-26(33)31(37-32)36-27-6-4-5-7-30(27)44(2,3)41/h4-9,20-21,24-25H,10-19,22H2,1-3H3,(H2,34,35,36,37) |
| InChIKey | XZUYLDPERBBVIH-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 95.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.17 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|