C23H25ClN5O3P — CID 164771628
2-N-(2,4,4a,5-tetrahydro-1H-[1,4]oxazino[3,4-c][1,4]benzoxazin-8-yl)-5-chloro-4-N-(2-dimethylphosphorylphenyl)pyrimidine-2,4-diamine (PubChem CID 164771628) has the molecular formula C23H25ClN5O3P and a molecular weight of 485.91 g/mol. Its IUPAC name is 2-N-(2,4,4a,5-tetrahydro-1H-[1,4]oxazino[3,4-c][1,4]benzoxazin-8-yl)-5-chloro-4-N-(2-dimethylphosphorylphenyl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-(2,4,4a,5-tetrahydro-1H-[1,4]oxazino[3,4-c][1,4]benzoxazin-8-yl)-5-chloro-4-N-(2-dimethylphosphorylphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 164771628 |
| Molecular Formula | C23H25ClN5O3P |
| Molecular Weight | 485.91 g/mol |
| Exact Mass | 485.14 |
| IUPAC Name | 2-N-(2,4,4a,5-tetrahydro-1H-[1,4]oxazino[3,4-c][1,4]benzoxazin-8-yl)-5-chloro-4-N-(2-dimethylphosphorylphenyl)pyrimidine-2,4-diamine |
| SMILES | CP(C)(=O)c1ccccc1Nc1nc(Nc2ccc3c(c2)OCC2COCCN32)ncc1Cl |
| InChI | InChI=1S/C23H25ClN5O3P/c1-33(2,30)21-6-4-3-5-18(21)27-22-17(24)12-25-23(28-22)26-15-7-8-19-20(11-15)32-14-16-13-31-10-9-29(16)19/h3-8,11-12,16H,9-10,13-14H2,1-2H3,(H2,25,26,27,28) |
| InChIKey | LZVDACSPMUMJQI-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.91 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|