C26H27Cl2N6O3P — CID 164771577
1-[(4aR)-10-chloro-8-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-2,4,4a,5-tetrahydro-1H-pyrazino[2,1-c][1,4]benzoxazin-3-yl]prop-2-en-1-one (PubChem CID 164771577) has the molecular formula C26H27Cl2N6O3P and a molecular weight of 573.42 g/mol. Its IUPAC name is 1-[(4aR)-10-chloro-8-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-2,4,4a,5-tetrahydro-1H-pyrazino[2,1-c][1,4]benzoxazin-3-yl]prop-2-en-1-one.
| Compound Name | 1-[(4aR)-10-chloro-8-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-2,4,4a,5-tetrahydro-1H-pyrazino[2,1-c][1,4]benzoxazin-3-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 164771577 |
| Molecular Formula | C26H27Cl2N6O3P |
| Molecular Weight | 573.42 g/mol |
| Exact Mass | 572.13 |
| IUPAC Name | 1-[(4aR)-10-chloro-8-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-2,4,4a,5-tetrahydro-1H-pyrazino[2,1-c][1,4]benzoxazin-3-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCN2c3c(Cl)cc(Nc4ncc(Cl)c(Nc5ccccc5P(C)(C)=O)n4)cc3OC[C@H]2C1 |
| InChI | InChI=1S/C26H27Cl2N6O3P/c1-4-23(35)33-9-10-34-17(14-33)15-37-21-12-16(11-18(27)24(21)34)30-26-29-13-19(28)25(32-26)31-20-7-5-6-8-22(20)38(2,3)36/h4-8,11-13,17H,1,9-10,14-15H2,2-3H3,(H2,29,30,31,32)/t17-/m1/s1 |
| InChIKey | JYFAZPKEKBBBKN-QGZVFWFLSA-N |
| XLogP | 5.11 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.42 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|