C29H33ClN7O3P — CID 164771626
1-[3-[(4aS)-8-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-2,4,4a,5-tetrahydro-1H-pyrazino[2,1-c][1,4]benzoxazin-3-yl]azetidin-1-yl]prop-2-en-1-one (PubChem CID 164771626) has the molecular formula C29H33ClN7O3P and a molecular weight of 594.06 g/mol. Its IUPAC name is 1-[3-[(4aS)-8-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-2,4,4a,5-tetrahydro-1H-pyrazino[2,1-c][1,4]benzoxazin-3-yl]azetidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[3-[(4aS)-8-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-2,4,4a,5-tetrahydro-1H-pyrazino[2,1-c][1,4]benzoxazin-3-yl]azetidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 164771626 |
| Molecular Formula | C29H33ClN7O3P |
| Molecular Weight | 594.06 g/mol |
| Exact Mass | 593.21 |
| IUPAC Name | 1-[3-[(4aS)-8-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-2,4,4a,5-tetrahydro-1H-pyrazino[2,1-c][1,4]benzoxazin-3-yl]azetidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CC(N2CCN3c4ccc(Nc5ncc(Cl)c(Nc6ccccc6P(C)(C)=O)n5)cc4OC[C@@H]3C2)C1 |
| InChI | InChI=1S/C29H33ClN7O3P/c1-4-27(38)36-15-20(16-36)35-11-12-37-21(17-35)18-40-25-13-19(9-10-24(25)37)32-29-31-14-22(30)28(34-29)33-23-7-5-6-8-26(23)41(2,3)39/h4-10,13-14,20-21H,1,11-12,15-18H2,2-3H3,(H2,31,32,33,34)/t21-/m0/s1 |
| InChIKey | HSUDSZBSNZBAEW-NRFANRHFSA-N |
| XLogP | 4.14 |
| TPSA | 102.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.06 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|