C24H27Cl2N6OP — CID 155005239
2-N-[4-(6-amino-2-azaspiro[3.3]heptan-2-yl)-3-chlorophenyl]-5-chloro-4-N-(2-dimethylphosphorylphenyl)pyrimidine-2,4-diamine (PubChem CID 155005239) has the molecular formula C24H27Cl2N6OP and a molecular weight of 517.40 g/mol. Its IUPAC name is 2-N-[4-(6-amino-2-azaspiro[3.3]heptan-2-yl)-3-chlorophenyl]-5-chloro-4-N-(2-dimethylphosphorylphenyl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-[4-(6-amino-2-azaspiro[3.3]heptan-2-yl)-3-chlorophenyl]-5-chloro-4-N-(2-dimethylphosphorylphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 155005239 |
| Molecular Formula | C24H27Cl2N6OP |
| Molecular Weight | 517.40 g/mol |
| Exact Mass | 516.14 |
| IUPAC Name | 2-N-[4-(6-amino-2-azaspiro[3.3]heptan-2-yl)-3-chlorophenyl]-5-chloro-4-N-(2-dimethylphosphorylphenyl)pyrimidine-2,4-diamine |
| SMILES | CP(C)(=O)c1ccccc1Nc1nc(Nc2ccc(N3CC4(CC(N)C4)C3)c(Cl)c2)ncc1Cl |
| InChI | InChI=1S/C24H27Cl2N6OP/c1-34(2,33)21-6-4-3-5-19(21)30-22-18(26)12-28-23(31-22)29-16-7-8-20(17(25)9-16)32-13-24(14-32)10-15(27)11-24/h3-9,12,15H,10-11,13-14,27H2,1-2H3,(H2,28,29,30,31) |
| InChIKey | JDZJOXMCDMRQKH-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.40 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|