C18H25ClN5OP — CID 71006703
2-N-(3-aminocyclohexyl)-5-chloro-4-N-(2-dimethylphosphorylphenyl)pyrimidine-2,4-diamine (PubChem CID 71006703) has the molecular formula C18H25ClN5OP and a molecular weight of 393.86 g/mol. Its IUPAC name is 2-N-(3-aminocyclohexyl)-5-chloro-4-N-(2-dimethylphosphorylphenyl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-(3-aminocyclohexyl)-5-chloro-4-N-(2-dimethylphosphorylphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 71006703 |
| Molecular Formula | C18H25ClN5OP |
| Molecular Weight | 393.86 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | 2-N-(3-aminocyclohexyl)-5-chloro-4-N-(2-dimethylphosphorylphenyl)pyrimidine-2,4-diamine |
| SMILES | CP(C)(=O)c1ccccc1Nc1nc(NC2CCCC(N)C2)ncc1Cl |
| InChI | InChI=1S/C18H25ClN5OP/c1-26(2,25)16-9-4-3-8-15(16)23-17-14(19)11-21-18(24-17)22-13-7-5-6-12(20)10-13/h3-4,8-9,11-13H,5-7,10,20H2,1-2H3,(H2,21,22,23,24) |
| InChIKey | OJXCVNVRDCSMAI-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.86 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|