C17H19ClN5O2P — CID 156501687
5-chloro-2-N-(3,4-dimethyl-1,2-oxazol-5-yl)-4-N-(2-dimethylphosphorylphenyl)pyrimidine-2,4-diamine (PubChem CID 156501687) has the molecular formula C17H19ClN5O2P and a molecular weight of 391.80 g/mol. Its IUPAC name is 5-chloro-2-N-(3,4-dimethyl-1,2-oxazol-5-yl)-4-N-(2-dimethylphosphorylphenyl)pyrimidine-2,4-diamine.
| Compound Name | 5-chloro-2-N-(3,4-dimethyl-1,2-oxazol-5-yl)-4-N-(2-dimethylphosphorylphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 156501687 |
| Molecular Formula | C17H19ClN5O2P |
| Molecular Weight | 391.80 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | 5-chloro-2-N-(3,4-dimethyl-1,2-oxazol-5-yl)-4-N-(2-dimethylphosphorylphenyl)pyrimidine-2,4-diamine |
| SMILES | Cc1noc(Nc2ncc(Cl)c(Nc3ccccc3P(C)(C)=O)n2)c1C |
| InChI | InChI=1S/C17H19ClN5O2P/c1-10-11(2)23-25-16(10)22-17-19-9-12(18)15(21-17)20-13-7-5-6-8-14(13)26(3,4)24/h5-9H,1-4H3,(H2,19,20,21,22) |
| InChIKey | PPKCEXXFAIAPIF-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.80 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|