C17H19Cl2N6OP — CID 149045331
5-chloro-2-N-[1-(2-chloroethyl)pyrazol-4-yl]-4-N-(2-dimethylphosphorylphenyl)pyrimidine-2,4-diamine (PubChem CID 149045331) has the molecular formula C17H19Cl2N6OP and a molecular weight of 425.26 g/mol. Its IUPAC name is 5-chloro-2-N-[1-(2-chloroethyl)pyrazol-4-yl]-4-N-(2-dimethylphosphorylphenyl)pyrimidine-2,4-diamine.
| Compound Name | 5-chloro-2-N-[1-(2-chloroethyl)pyrazol-4-yl]-4-N-(2-dimethylphosphorylphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 149045331 |
| Molecular Formula | C17H19Cl2N6OP |
| Molecular Weight | 425.26 g/mol |
| Exact Mass | 424.07 |
| IUPAC Name | 5-chloro-2-N-[1-(2-chloroethyl)pyrazol-4-yl]-4-N-(2-dimethylphosphorylphenyl)pyrimidine-2,4-diamine |
| SMILES | CP(C)(=O)c1ccccc1Nc1nc(Nc2cnn(CCCl)c2)ncc1Cl |
| InChI | InChI=1S/C17H19Cl2N6OP/c1-27(2,26)15-6-4-3-5-14(15)23-16-13(19)10-20-17(24-16)22-12-9-21-25(11-12)8-7-18/h3-6,9-11H,7-8H2,1-2H3,(H2,20,22,23,24) |
| InChIKey | QIKASSPXFKRNPU-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.26 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|