C20H21BrClN4OP — CID 172622538
5-bromo-2-N-(3-chloro-4-ethylphenyl)-4-N-(2-dimethylphosphorylphenyl)pyrimidine-2,4-diamine (PubChem CID 172622538) has the molecular formula C20H21BrClN4OP and a molecular weight of 479.75 g/mol. Its IUPAC name is 5-bromo-2-N-(3-chloro-4-ethylphenyl)-4-N-(2-dimethylphosphorylphenyl)pyrimidine-2,4-diamine.
| Compound Name | 5-bromo-2-N-(3-chloro-4-ethylphenyl)-4-N-(2-dimethylphosphorylphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 172622538 |
| Molecular Formula | C20H21BrClN4OP |
| Molecular Weight | 479.75 g/mol |
| Exact Mass | 478.03 |
| IUPAC Name | 5-bromo-2-N-(3-chloro-4-ethylphenyl)-4-N-(2-dimethylphosphorylphenyl)pyrimidine-2,4-diamine |
| SMILES | CCc1ccc(Nc2ncc(Br)c(Nc3ccccc3P(C)(C)=O)n2)cc1Cl |
| InChI | InChI=1S/C20H21BrClN4OP/c1-4-13-9-10-14(11-16(13)22)24-20-23-12-15(21)19(26-20)25-17-7-5-6-8-18(17)28(2,3)27/h5-12H,4H2,1-3H3,(H2,23,24,25,26) |
| InChIKey | PLJJUZISWYMQGH-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.75 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|