C26H30ClN6O2P — CID 155183929
2-[2-amino-4-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]phenyl]-2-azaspiro[3.5]nonan-7-one (PubChem CID 155183929) has the molecular formula C26H30ClN6O2P and a molecular weight of 524.99 g/mol. Its IUPAC name is 2-[2-amino-4-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]phenyl]-2-azaspiro[3.5]nonan-7-one.
| Compound Name | 2-[2-amino-4-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]phenyl]-2-azaspiro[3.5]nonan-7-one |
|---|---|
| PubChem CID | 155183929 |
| Molecular Formula | C26H30ClN6O2P |
| Molecular Weight | 524.99 g/mol |
| Exact Mass | 524.19 |
| IUPAC Name | 2-[2-amino-4-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]phenyl]-2-azaspiro[3.5]nonan-7-one |
| SMILES | CP(C)(=O)c1ccccc1Nc1nc(Nc2ccc(N3CC4(CCC(=O)CC4)C3)c(N)c2)ncc1Cl |
| InChI | InChI=1S/C26H30ClN6O2P/c1-36(2,35)23-6-4-3-5-21(23)31-24-19(27)14-29-25(32-24)30-17-7-8-22(20(28)13-17)33-15-26(16-33)11-9-18(34)10-12-26/h3-8,13-14H,9-12,15-16,28H2,1-2H3,(H2,29,30,31,32) |
| InChIKey | IDDDLWWOBVUIPE-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 113.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.99 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|