C32H40Cl2N5O3P — CID 163463687
tert-butyl 2-[7-[2-chloro-4-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]phenyl]-7-azaspiro[3.5]nonan-2-yl]acetate (PubChem CID 163463687) has the molecular formula C32H40Cl2N5O3P and a molecular weight of 644.58 g/mol. Its IUPAC name is tert-butyl 2-[7-[2-chloro-4-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]phenyl]-7-azaspiro[3.5]nonan-2-yl]acetate.
| Compound Name | tert-butyl 2-[7-[2-chloro-4-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]phenyl]-7-azaspiro[3.5]nonan-2-yl]acetate |
|---|---|
| PubChem CID | 163463687 |
| Molecular Formula | C32H40Cl2N5O3P |
| Molecular Weight | 644.58 g/mol |
| Exact Mass | 643.22 |
| IUPAC Name | tert-butyl 2-[7-[2-chloro-4-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]phenyl]-7-azaspiro[3.5]nonan-2-yl]acetate |
| SMILES | CC(C)(C)OC(=O)CC1CC2(CCN(c3ccc(Nc4ncc(Cl)c(Nc5ccccc5P(C)(C)=O)n4)cc3Cl)CC2)C1 |
| InChI | InChI=1S/C32H40Cl2N5O3P/c1-31(2,3)42-28(40)16-21-18-32(19-21)12-14-39(15-13-32)26-11-10-22(17-23(26)33)36-30-35-20-24(34)29(38-30)37-25-8-6-7-9-27(25)43(4,5)41/h6-11,17,20-21H,12-16,18-19H2,1-5H3,(H2,35,36,37,38) |
| InChIKey | UUXXEXDEGZARQH-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.58 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|