C29H37ClN7O4P — CID 163733163
5-chloro-2-N-[4-[2-(dimethylamino)-7-azaspiro[3.5]nonan-7-yl]-2-methoxy-5-nitrophenyl]-4-N-(2-dimethylphosphorylphenyl)pyrimidine-2,4-diamine (PubChem CID 163733163) has the molecular formula C29H37ClN7O4P and a molecular weight of 614.09 g/mol. Its IUPAC name is 5-chloro-2-N-[4-[2-(dimethylamino)-7-azaspiro[3.5]nonan-7-yl]-2-methoxy-5-nitrophenyl]-4-N-(2-dimethylphosphorylphenyl)pyrimidine-2,4-diamine.
| Compound Name | 5-chloro-2-N-[4-[2-(dimethylamino)-7-azaspiro[3.5]nonan-7-yl]-2-methoxy-5-nitrophenyl]-4-N-(2-dimethylphosphorylphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 163733163 |
| Molecular Formula | C29H37ClN7O4P |
| Molecular Weight | 614.09 g/mol |
| Exact Mass | 613.23 |
| IUPAC Name | 5-chloro-2-N-[4-[2-(dimethylamino)-7-azaspiro[3.5]nonan-7-yl]-2-methoxy-5-nitrophenyl]-4-N-(2-dimethylphosphorylphenyl)pyrimidine-2,4-diamine |
| SMILES | COc1cc(N2CCC3(CC2)CC(N(C)C)C3)c([N+](=O)[O-])cc1Nc1ncc(Cl)c(Nc2ccccc2P(C)(C)=O)n1 |
| InChI | InChI=1S/C29H37ClN7O4P/c1-35(2)19-16-29(17-19)10-12-36(13-11-29)23-15-25(41-3)22(14-24(23)37(38)39)33-28-31-18-20(30)27(34-28)32-21-8-6-7-9-26(21)42(4,5)40/h6-9,14-15,18-19H,10-13,16-17H2,1-5H3,(H2,31,32,33,34) |
| InChIKey | LBISAYNJUXPNKE-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 125.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.09 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|