C29H38FN8O4P — CID 164820900
4-N-(2-dimethylphosphorylphenyl)-5-fluoro-2-N-[2-methoxy-4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]-5-nitrophenyl]pyrimidine-2,4-diamine (PubChem CID 164820900) has the molecular formula C29H38FN8O4P and a molecular weight of 612.65 g/mol. Its IUPAC name is 4-N-(2-dimethylphosphorylphenyl)-5-fluoro-2-N-[2-methoxy-4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]-5-nitrophenyl]pyrimidine-2,4-diamine.
| Compound Name | 4-N-(2-dimethylphosphorylphenyl)-5-fluoro-2-N-[2-methoxy-4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]-5-nitrophenyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 164820900 |
| Molecular Formula | C29H38FN8O4P |
| Molecular Weight | 612.65 g/mol |
| Exact Mass | 612.27 |
| IUPAC Name | 4-N-(2-dimethylphosphorylphenyl)-5-fluoro-2-N-[2-methoxy-4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]-5-nitrophenyl]pyrimidine-2,4-diamine |
| SMILES | COc1cc(N2CCC(N3CCN(C)CC3)CC2)c([N+](=O)[O-])cc1Nc1ncc(F)c(Nc2ccccc2P(C)(C)=O)n1 |
| InChI | InChI=1S/C29H38FN8O4P/c1-35-13-15-36(16-14-35)20-9-11-37(12-10-20)24-18-26(42-2)23(17-25(24)38(39)40)33-29-31-19-21(30)28(34-29)32-22-7-5-6-8-27(22)43(3,4)41/h5-8,17-20H,9-16H2,1-4H3,(H2,31,32,33,34) |
| InChIKey | XMHSNMRKILSYOE-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 129.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.65 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|