C33H44BrN8O5P — CID 176856559
tert-butyl 4-[1-[4-[[5-bromo-4-(2-dimethylphosphanylanilino)pyrimidin-2-yl]amino]-5-methoxy-2-nitrophenyl]piperidin-4-yl]piperazine-1-carboxylate (PubChem CID 176856559) has the molecular formula C33H44BrN8O5P and a molecular weight of 743.64 g/mol. Its IUPAC name is tert-butyl 4-[1-[4-[[5-bromo-4-(2-dimethylphosphanylanilino)pyrimidin-2-yl]amino]-5-methoxy-2-nitrophenyl]piperidin-4-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[1-[4-[[5-bromo-4-(2-dimethylphosphanylanilino)pyrimidin-2-yl]amino]-5-methoxy-2-nitrophenyl]piperidin-4-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 176856559 |
| Molecular Formula | C33H44BrN8O5P |
| Molecular Weight | 743.64 g/mol |
| Exact Mass | 742.24 |
| IUPAC Name | tert-butyl 4-[1-[4-[[5-bromo-4-(2-dimethylphosphanylanilino)pyrimidin-2-yl]amino]-5-methoxy-2-nitrophenyl]piperidin-4-yl]piperazine-1-carboxylate |
| SMILES | COc1cc(N2CCC(N3CCN(C(=O)OC(C)(C)C)CC3)CC2)c([N+](=O)[O-])cc1Nc1ncc(Br)c(Nc2ccccc2P(C)C)n1 |
| InChI | InChI=1S/C33H44BrN8O5P/c1-33(2,3)47-32(43)41-17-15-39(16-18-41)22-11-13-40(14-12-22)26-20-28(46-4)25(19-27(26)42(44)45)37-31-35-21-23(34)30(38-31)36-24-9-7-8-10-29(24)48(5)6/h7-10,19-22H,11-18H2,1-6H3,(H2,35,36,37,38) |
| InChIKey | HGRHAHCPMVHHTN-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 138.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.64 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|