C32H44BrN8O3P — CID 176856611
tert-butyl 4-[1-[2-amino-4-[[5-bromo-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]phenyl]piperidin-4-yl]piperazine-1-carboxylate (PubChem CID 176856611) has the molecular formula C32H44BrN8O3P and a molecular weight of 699.64 g/mol. Its IUPAC name is tert-butyl 4-[1-[2-amino-4-[[5-bromo-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]phenyl]piperidin-4-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[1-[2-amino-4-[[5-bromo-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]phenyl]piperidin-4-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 176856611 |
| Molecular Formula | C32H44BrN8O3P |
| Molecular Weight | 699.64 g/mol |
| Exact Mass | 698.25 |
| IUPAC Name | tert-butyl 4-[1-[2-amino-4-[[5-bromo-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]phenyl]piperidin-4-yl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(C2CCN(c3ccc(Nc4ncc(Br)c(Nc5ccccc5P(C)(C)=O)n4)cc3N)CC2)CC1 |
| InChI | InChI=1S/C32H44BrN8O3P/c1-32(2,3)44-31(42)41-18-16-39(17-19-41)23-12-14-40(15-13-23)27-11-10-22(20-25(27)34)36-30-35-21-24(33)29(38-30)37-26-8-6-7-9-28(26)45(4,5)43/h6-11,20-21,23H,12-19,34H2,1-5H3,(H2,35,36,37,38) |
| InChIKey | AWLRRKZHIWMYTG-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 128.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.64 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|