C31H43ClN7O2P — CID 175205729
5-chloro-4-N-(2-dimethylphosphorylphenyl)-2-N-[4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]-3-propan-2-yloxyphenyl]pyrimidine-2,4-diamine (PubChem CID 175205729) has the molecular formula C31H43ClN7O2P and a molecular weight of 612.16 g/mol. Its IUPAC name is 5-chloro-4-N-(2-dimethylphosphorylphenyl)-2-N-[4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]-3-propan-2-yloxyphenyl]pyrimidine-2,4-diamine.
| Compound Name | 5-chloro-4-N-(2-dimethylphosphorylphenyl)-2-N-[4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]-3-propan-2-yloxyphenyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 175205729 |
| Molecular Formula | C31H43ClN7O2P |
| Molecular Weight | 612.16 g/mol |
| Exact Mass | 611.29 |
| IUPAC Name | 5-chloro-4-N-(2-dimethylphosphorylphenyl)-2-N-[4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]-3-propan-2-yloxyphenyl]pyrimidine-2,4-diamine |
| SMILES | CC(C)Oc1cc(Nc2ncc(Cl)c(Nc3ccccc3P(C)(C)=O)n2)ccc1N1CCC(N2CCN(C)CC2)CC1 |
| InChI | InChI=1S/C31H43ClN7O2P/c1-22(2)41-28-20-23(10-11-27(28)39-14-12-24(13-15-39)38-18-16-37(3)17-19-38)34-31-33-21-25(32)30(36-31)35-26-8-6-7-9-29(26)42(4,5)40/h6-11,20-22,24H,12-19H2,1-5H3,(H2,33,34,35,36) |
| InChIKey | AKLITULDRPNYCJ-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 85.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.16 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|