C25H32ClN7O3S — CID 162732636
N-[4-[[5-chloro-2-[4-(4-methylpiperazin-1-yl)-3-propan-2-yloxyanilino]pyrimidin-4-yl]amino]phenyl]methanesulfonamide (PubChem CID 162732636) has the molecular formula C25H32ClN7O3S and a molecular weight of 546.10 g/mol. Its IUPAC name is N-[4-[[5-chloro-2-[4-(4-methylpiperazin-1-yl)-3-propan-2-yloxyanilino]pyrimidin-4-yl]amino]phenyl]methanesulfonamide.
| Compound Name | N-[4-[[5-chloro-2-[4-(4-methylpiperazin-1-yl)-3-propan-2-yloxyanilino]pyrimidin-4-yl]amino]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 162732636 |
| Molecular Formula | C25H32ClN7O3S |
| Molecular Weight | 546.10 g/mol |
| Exact Mass | 545.20 |
| IUPAC Name | N-[4-[[5-chloro-2-[4-(4-methylpiperazin-1-yl)-3-propan-2-yloxyanilino]pyrimidin-4-yl]amino]phenyl]methanesulfonamide |
| SMILES | CC(C)Oc1cc(Nc2ncc(Cl)c(Nc3ccc(NS(C)(=O)=O)cc3)n2)ccc1N1CCN(C)CC1 |
| InChI | InChI=1S/C25H32ClN7O3S/c1-17(2)36-23-15-20(9-10-22(23)33-13-11-32(3)12-14-33)29-25-27-16-21(26)24(30-25)28-18-5-7-19(8-6-18)31-37(4,34)35/h5-10,15-17,31H,11-14H2,1-4H3,(H2,27,28,29,30) |
| InChIKey | RFSRAIPULPUSIK-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 111.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.10 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|