C31H43ClN7O4P — CID 163206458
5-chloro-4-N-(2-dimethoxyphosphanylphenyl)-2-N-[3-(2-methoxyethoxy)-4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]phenyl]pyrimidine-2,4-diamine (PubChem CID 163206458) has the molecular formula C31H43ClN7O4P and a molecular weight of 644.16 g/mol. Its IUPAC name is 5-chloro-4-N-(2-dimethoxyphosphanylphenyl)-2-N-[3-(2-methoxyethoxy)-4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]phenyl]pyrimidine-2,4-diamine.
| Compound Name | 5-chloro-4-N-(2-dimethoxyphosphanylphenyl)-2-N-[3-(2-methoxyethoxy)-4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]phenyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 163206458 |
| Molecular Formula | C31H43ClN7O4P |
| Molecular Weight | 644.16 g/mol |
| Exact Mass | 643.28 |
| IUPAC Name | 5-chloro-4-N-(2-dimethoxyphosphanylphenyl)-2-N-[3-(2-methoxyethoxy)-4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]phenyl]pyrimidine-2,4-diamine |
| SMILES | COCCOc1cc(Nc2ncc(Cl)c(Nc3ccccc3P(OC)OC)n2)ccc1N1CCC(N2CCN(C)CC2)CC1 |
| InChI | InChI=1S/C31H43ClN7O4P/c1-37-15-17-38(18-16-37)24-11-13-39(14-12-24)27-10-9-23(21-28(27)43-20-19-40-2)34-31-33-22-25(32)30(36-31)35-26-7-5-6-8-29(26)44(41-3)42-4/h5-10,21-22,24H,11-20H2,1-4H3,(H2,33,34,35,36) |
| InChIKey | VRTATQSBKCQODY-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 96.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.16 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|