C22H29ClN6O3 — CID 169085574
5-chloro-2-[3-methoxy-4-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]anilino]pyrimidine-4-carboxylic acid (PubChem CID 169085574) has the molecular formula C22H29ClN6O3 and a molecular weight of 460.97 g/mol. Its IUPAC name is 5-chloro-2-[3-methoxy-4-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]anilino]pyrimidine-4-carboxylic acid.
| Compound Name | 5-chloro-2-[3-methoxy-4-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]anilino]pyrimidine-4-carboxylic acid |
|---|---|
| PubChem CID | 169085574 |
| Molecular Formula | C22H29ClN6O3 |
| Molecular Weight | 460.97 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | 5-chloro-2-[3-methoxy-4-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]anilino]pyrimidine-4-carboxylic acid |
| SMILES | COc1cc(Nc2ncc(Cl)c(C(=O)O)n2)ccc1N1CCN(C2CCN(C)CC2)CC1 |
| InChI | InChI=1S/C22H29ClN6O3/c1-27-7-5-16(6-8-27)28-9-11-29(12-10-28)18-4-3-15(13-19(18)32-2)25-22-24-14-17(23)20(26-22)21(30)31/h3-4,13-14,16H,5-12H2,1-2H3,(H,30,31)(H,24,25,26) |
| InChIKey | DXRLBLATXRWOHS-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.97 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|