C18H21N5O2 — CID 141314522
N-[3-methoxy-4-(4-methylpiperazin-1-yl)phenyl]furo[3,2-d]pyrimidin-2-amine (PubChem CID 141314522) has the molecular formula C18H21N5O2 and a molecular weight of 339.40 g/mol. Its IUPAC name is N-[3-methoxy-4-(4-methylpiperazin-1-yl)phenyl]furo[3,2-d]pyrimidin-2-amine.
| Compound Name | N-[3-methoxy-4-(4-methylpiperazin-1-yl)phenyl]furo[3,2-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 141314522 |
| Molecular Formula | C18H21N5O2 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | N-[3-methoxy-4-(4-methylpiperazin-1-yl)phenyl]furo[3,2-d]pyrimidin-2-amine |
| SMILES | COc1cc(Nc2ncc3occc3n2)ccc1N1CCN(C)CC1 |
| InChI | InChI=1S/C18H21N5O2/c1-22-6-8-23(9-7-22)15-4-3-13(11-16(15)24-2)20-18-19-12-17-14(21-18)5-10-25-17/h3-5,10-12H,6-9H2,1-2H3,(H,19,20,21) |
| InChIKey | NLNNOIKOVSBVIE-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 66.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|