C17H21IN4O — CID 71540971
4-iodo-N-[3-methoxy-4-(4-methylpiperazin-1-yl)phenyl]pyridin-2-amine (PubChem CID 71540971) has the molecular formula C17H21IN4O and a molecular weight of 424.29 g/mol. Its IUPAC name is 4-iodo-N-[3-methoxy-4-(4-methylpiperazin-1-yl)phenyl]pyridin-2-amine.
| Compound Name | 4-iodo-N-[3-methoxy-4-(4-methylpiperazin-1-yl)phenyl]pyridin-2-amine |
|---|---|
| PubChem CID | 71540971 |
| Molecular Formula | C17H21IN4O |
| Molecular Weight | 424.29 g/mol |
| Exact Mass | 424.08 |
| IUPAC Name | 4-iodo-N-[3-methoxy-4-(4-methylpiperazin-1-yl)phenyl]pyridin-2-amine |
| SMILES | COc1cc(Nc2cc(I)ccn2)ccc1N1CCN(C)CC1 |
| InChI | InChI=1S/C17H21IN4O/c1-21-7-9-22(10-8-21)15-4-3-14(12-16(15)23-2)20-17-11-13(18)5-6-19-17/h3-6,11-12H,7-10H2,1-2H3,(H,19,20) |
| InChIKey | JAUWMYTWSAZXGT-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 40.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.29 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|