C23H24N6O3 — CID 117077782
N-(3-methoxy-4-morpholin-4-ylphenyl)-4-[4-(1-methylpyrazol-4-yl)-1,2-oxazol-3-yl]pyridin-2-amine (PubChem CID 117077782) has the molecular formula C23H24N6O3 and a molecular weight of 432.48 g/mol. Its IUPAC name is N-(3-methoxy-4-morpholin-4-ylphenyl)-4-[4-(1-methylpyrazol-4-yl)-1,2-oxazol-3-yl]pyridin-2-amine.
| Compound Name | N-(3-methoxy-4-morpholin-4-ylphenyl)-4-[4-(1-methylpyrazol-4-yl)-1,2-oxazol-3-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 117077782 |
| Molecular Formula | C23H24N6O3 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | N-(3-methoxy-4-morpholin-4-ylphenyl)-4-[4-(1-methylpyrazol-4-yl)-1,2-oxazol-3-yl]pyridin-2-amine |
| SMILES | COc1cc(Nc2cc(-c3nocc3-c3cnn(C)c3)ccn2)ccc1N1CCOCC1 |
| InChI | InChI=1S/C23H24N6O3/c1-28-14-17(13-25-28)19-15-32-27-23(19)16-5-6-24-22(11-16)26-18-3-4-20(21(12-18)30-2)29-7-9-31-10-8-29/h3-6,11-15H,7-10H2,1-2H3,(H,24,26) |
| InChIKey | SXWSQSUYNAPQFP-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 90.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|