C26H26N6O4 — CID 72695166
7-[8-(3-methoxy-4-morpholin-4-ylanilino)imidazo[1,2-a]pyrazin-6-yl]-3,4-dihydro-2H-1,4-benzoxazepin-5-one (PubChem CID 72695166) has the molecular formula C26H26N6O4 and a molecular weight of 486.53 g/mol. Its IUPAC name is 7-[8-(3-methoxy-4-morpholin-4-ylanilino)imidazo[1,2-a]pyrazin-6-yl]-3,4-dihydro-2H-1,4-benzoxazepin-5-one.
| Compound Name | 7-[8-(3-methoxy-4-morpholin-4-ylanilino)imidazo[1,2-a]pyrazin-6-yl]-3,4-dihydro-2H-1,4-benzoxazepin-5-one |
|---|---|
| PubChem CID | 72695166 |
| Molecular Formula | C26H26N6O4 |
| Molecular Weight | 486.53 g/mol |
| Exact Mass | 486.20 |
| IUPAC Name | 7-[8-(3-methoxy-4-morpholin-4-ylanilino)imidazo[1,2-a]pyrazin-6-yl]-3,4-dihydro-2H-1,4-benzoxazepin-5-one |
| SMILES | COc1cc(Nc2nc(-c3ccc4c(c3)C(=O)NCCO4)cn3ccnc23)ccc1N1CCOCC1 |
| InChI | InChI=1S/C26H26N6O4/c1-34-23-15-18(3-4-21(23)31-9-12-35-13-10-31)29-24-25-27-6-8-32(25)16-20(30-24)17-2-5-22-19(14-17)26(33)28-7-11-36-22/h2-6,8,14-16H,7,9-13H2,1H3,(H,28,33)(H,29,30) |
| InChIKey | WKWXJVFYGZFENZ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 102.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.53 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|