C25H26N6O2 — CID 91489187
6-(3,4-dihydro-2H-1,4-benzoxazin-6-yl)-N-(3-methoxy-4-pyrrolidin-1-ylphenyl)imidazo[1,2-a]pyrazin-8-amine (PubChem CID 91489187) has the molecular formula C25H26N6O2 and a molecular weight of 442.52 g/mol. Its IUPAC name is 6-(3,4-dihydro-2H-1,4-benzoxazin-6-yl)-N-(3-methoxy-4-pyrrolidin-1-ylphenyl)imidazo[1,2-a]pyrazin-8-amine.
| Compound Name | 6-(3,4-dihydro-2H-1,4-benzoxazin-6-yl)-N-(3-methoxy-4-pyrrolidin-1-ylphenyl)imidazo[1,2-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 91489187 |
| Molecular Formula | C25H26N6O2 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | 6-(3,4-dihydro-2H-1,4-benzoxazin-6-yl)-N-(3-methoxy-4-pyrrolidin-1-ylphenyl)imidazo[1,2-a]pyrazin-8-amine |
| SMILES | COc1cc(Nc2nc(-c3ccc4c(c3)NCCO4)cn3ccnc23)ccc1N1CCCC1 |
| InChI | InChI=1S/C25H26N6O2/c1-32-23-15-18(5-6-21(23)30-10-2-3-11-30)28-24-25-27-8-12-31(25)16-20(29-24)17-4-7-22-19(14-17)26-9-13-33-22/h4-8,12,14-16,26H,2-3,9-11,13H2,1H3,(H,28,29) |
| InChIKey | NBKYMCIIDIUOBF-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 75.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|