C15H20N4O2 — CID 168524286
2-cyano-N-[3-methoxy-4-(4-methylpiperazin-1-yl)phenyl]acetamide (PubChem CID 168524286) has the molecular formula C15H20N4O2 and a molecular weight of 288.35 g/mol. Its IUPAC name is 2-cyano-N-[3-methoxy-4-(4-methylpiperazin-1-yl)phenyl]acetamide.
| Compound Name | 2-cyano-N-[3-methoxy-4-(4-methylpiperazin-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 168524286 |
| Molecular Formula | C15H20N4O2 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 2-cyano-N-[3-methoxy-4-(4-methylpiperazin-1-yl)phenyl]acetamide |
| SMILES | COc1cc(NC(=O)CC#N)ccc1N1CCN(C)CC1 |
| InChI | InChI=1S/C15H20N4O2/c1-18-7-9-19(10-8-18)13-4-3-12(11-14(13)21-2)17-15(20)5-6-16/h3-4,11H,5,7-10H2,1-2H3,(H,17,20) |
| InChIKey | HIZIJJNAEQHXHK-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 68.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|