C14H17FN4O — CID 168520629
2-cyano-N-[5-fluoro-2-(4-methylpiperazin-1-yl)phenyl]acetamide (PubChem CID 168520629) has the molecular formula C14H17FN4O and a molecular weight of 276.32 g/mol. Its IUPAC name is 2-cyano-N-[5-fluoro-2-(4-methylpiperazin-1-yl)phenyl]acetamide.
| Compound Name | 2-cyano-N-[5-fluoro-2-(4-methylpiperazin-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 168520629 |
| Molecular Formula | C14H17FN4O |
| Molecular Weight | 276.32 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 2-cyano-N-[5-fluoro-2-(4-methylpiperazin-1-yl)phenyl]acetamide |
| SMILES | CN1CCN(c2ccc(F)cc2NC(=O)CC#N)CC1 |
| InChI | InChI=1S/C14H17FN4O/c1-18-6-8-19(9-7-18)13-3-2-11(15)10-12(13)17-14(20)4-5-16/h2-3,10H,4,6-9H2,1H3,(H,17,20) |
| InChIKey | NCRUFHJAZFYNGN-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 59.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.32 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |