C15H16N4O — CID 168523631
2-cyano-N-(5-cyano-2-piperidin-1-ylphenyl)acetamide (PubChem CID 168523631) has the molecular formula C15H16N4O and a molecular weight of 268.32 g/mol. Its IUPAC name is 2-cyano-N-(5-cyano-2-piperidin-1-ylphenyl)acetamide.
| Compound Name | 2-cyano-N-(5-cyano-2-piperidin-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 168523631 |
| Molecular Formula | C15H16N4O |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 2-cyano-N-(5-cyano-2-piperidin-1-ylphenyl)acetamide |
| SMILES | N#CCC(=O)Nc1cc(C#N)ccc1N1CCCCC1 |
| InChI | InChI=1S/C15H16N4O/c16-7-6-15(20)18-13-10-12(11-17)4-5-14(13)19-8-2-1-3-9-19/h4-5,10H,1-3,6,8-9H2,(H,18,20) |
| InChIKey | KLWMOFHPLJNAHL-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 79.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |