C14H15N5O5 — CID 168523677
2-cyano-N-(2,4-dinitro-5-piperidin-1-ylphenyl)acetamide (PubChem CID 168523677) has the molecular formula C14H15N5O5 and a molecular weight of 333.30 g/mol. Its IUPAC name is 2-cyano-N-(2,4-dinitro-5-piperidin-1-ylphenyl)acetamide.
| Compound Name | 2-cyano-N-(2,4-dinitro-5-piperidin-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 168523677 |
| Molecular Formula | C14H15N5O5 |
| Molecular Weight | 333.30 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | 2-cyano-N-(2,4-dinitro-5-piperidin-1-ylphenyl)acetamide |
| SMILES | N#CCC(=O)Nc1cc(N2CCCCC2)c([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H15N5O5/c15-5-4-14(20)16-10-8-12(17-6-2-1-3-7-17)13(19(23)24)9-11(10)18(21)22/h8-9H,1-4,6-7H2,(H,16,20) |
| InChIKey | SZWZSNMJWLQVKC-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 142.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.30 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|