C13H18N4O5 — CID 2842390
2-(2,4-dinitro-5-piperidin-1-ylanilino)ethanol (PubChem CID 2842390) has the molecular formula C13H18N4O5 and a molecular weight of 310.31 g/mol. Its IUPAC name is 2-(2,4-dinitro-5-piperidin-1-ylanilino)ethanol.
| Compound Name | 2-(2,4-dinitro-5-piperidin-1-ylanilino)ethanol |
|---|---|
| PubChem CID | 2842390 |
| Molecular Formula | C13H18N4O5 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | 2-(2,4-dinitro-5-piperidin-1-ylanilino)ethanol |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c(N2CCCCC2)cc1NCCO |
| InChI | InChI=1S/C13H18N4O5/c18-7-4-14-10-8-12(15-5-2-1-3-6-15)13(17(21)22)9-11(10)16(19)20/h8-9,14,18H,1-7H2 |
| InChIKey | YPQLLDKYTMPTKT-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 121.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|