C13H16ClN5O4 — CID 169369027
2-chloro-N'-(2,4-dinitro-5-piperidin-1-ylphenyl)ethanimidamide (PubChem CID 169369027) has the molecular formula C13H16ClN5O4 and a molecular weight of 341.76 g/mol. Its IUPAC name is 2-chloro-N'-(2,4-dinitro-5-piperidin-1-ylphenyl)ethanimidamide.
| Compound Name | 2-chloro-N'-(2,4-dinitro-5-piperidin-1-ylphenyl)ethanimidamide |
|---|---|
| PubChem CID | 169369027 |
| Molecular Formula | C13H16ClN5O4 |
| Molecular Weight | 341.76 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | 2-chloro-N'-(2,4-dinitro-5-piperidin-1-ylphenyl)ethanimidamide |
| SMILES | N/C(CCl)=N/c1cc(N2CCCCC2)c([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H16ClN5O4/c14-8-13(15)16-9-6-11(17-4-2-1-3-5-17)12(19(22)23)7-10(9)18(20)21/h6-7H,1-5,8H2,(H2,15,16) |
| InChIKey | UNEDJSOSKBTQBR-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 127.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.76 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|