C18H30N6O6+2 — CID 7154427
2-[4-[5-[4-(2-hydroxyethyl)piperazin-4-ium-1-yl]-2,4-dinitrophenyl]piperazin-1-ium-1-yl]ethanol (PubChem CID 7154427) has the molecular formula C18H30N6O6+2 and a molecular weight of 426.47 g/mol. Its IUPAC name is 2-[4-[5-[4-(2-hydroxyethyl)piperazin-4-ium-1-yl]-2,4-dinitrophenyl]piperazin-1-ium-1-yl]ethanol.
| Compound Name | 2-[4-[5-[4-(2-hydroxyethyl)piperazin-4-ium-1-yl]-2,4-dinitrophenyl]piperazin-1-ium-1-yl]ethanol |
|---|---|
| PubChem CID | 7154427 |
| Molecular Formula | C18H30N6O6+2 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | 2-[4-[5-[4-(2-hydroxyethyl)piperazin-4-ium-1-yl]-2,4-dinitrophenyl]piperazin-1-ium-1-yl]ethanol |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c(N2CC[NH+](CCO)CC2)cc1N1CC[NH+](CCO)CC1 |
| InChI | InChI=1S/C18H28N6O6/c25-11-9-19-1-5-21(6-2-19)15-13-16(18(24(29)30)14-17(15)23(27)28)22-7-3-20(4-8-22)10-12-26/h13-14,25-26H,1-12H2/p+2 |
| InChIKey | XKFDCOXBOSLLBY-UHFFFAOYSA-P |
| XLogP | -3.10 |
| TPSA | 142.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | -3.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|