C12H17N4O5+ — CID 7122193
2-[4-(2,4-dinitrophenyl)piperazin-1-ium-1-yl]ethanol (PubChem CID 7122193) has the molecular formula C12H17N4O5+ and a molecular weight of 297.29 g/mol. Its IUPAC name is 2-[4-(2,4-dinitrophenyl)piperazin-1-ium-1-yl]ethanol.
| Compound Name | 2-[4-(2,4-dinitrophenyl)piperazin-1-ium-1-yl]ethanol |
|---|---|
| PubChem CID | 7122193 |
| Molecular Formula | C12H17N4O5+ |
| Molecular Weight | 297.29 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | 2-[4-(2,4-dinitrophenyl)piperazin-1-ium-1-yl]ethanol |
| SMILES | O=[N+]([O-])c1ccc(N2CC[NH+](CCO)CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H16N4O5/c17-8-7-13-3-5-14(6-4-13)11-2-1-10(15(18)19)9-12(11)16(20)21/h1-2,9,17H,3-8H2/p+1 |
| InChIKey | OTIKRXAYHNUNSB-UHFFFAOYSA-O |
| XLogP | -0.80 |
| TPSA | 114.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.29 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|