C11H12N4O5 — CID 71900709
1-(2,4-dinitrophenyl)-1,4-diazepan-5-one (PubChem CID 71900709) has the molecular formula C11H12N4O5 and a molecular weight of 280.24 g/mol. Its IUPAC name is 1-(2,4-dinitrophenyl)-1,4-diazepan-5-one.
| Compound Name | 1-(2,4-dinitrophenyl)-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 71900709 |
| Molecular Formula | C11H12N4O5 |
| Molecular Weight | 280.24 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 1-(2,4-dinitrophenyl)-1,4-diazepan-5-one |
| SMILES | O=C1CCN(c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])CCN1 |
| InChI | InChI=1S/C11H12N4O5/c16-11-3-5-13(6-4-12-11)9-2-1-8(14(17)18)7-10(9)15(19)20/h1-2,7H,3-6H2,(H,12,16) |
| InChIKey | HDWCPZOQHCALPW-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 118.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.24 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|