C22H29FN8O8 — CID 158807698
1-(2,4-dinitrophenyl)-4-methylpiperazine;1-fluoro-2,4-dinitrobenzene;1-methylpiperazine (PubChem CID 158807698) has the molecular formula C22H29FN8O8 and a molecular weight of 552.52 g/mol. Its IUPAC name is 1-(2,4-dinitrophenyl)-4-methylpiperazine;1-fluoro-2,4-dinitrobenzene;1-methylpiperazine.
| Compound Name | 1-(2,4-dinitrophenyl)-4-methylpiperazine;1-fluoro-2,4-dinitrobenzene;1-methylpiperazine |
|---|---|
| PubChem CID | 158807698 |
| Molecular Formula | C22H29FN8O8 |
| Molecular Weight | 552.52 g/mol |
| Exact Mass | 552.21 |
| IUPAC Name | 1-(2,4-dinitrophenyl)-4-methylpiperazine;1-fluoro-2,4-dinitrobenzene;1-methylpiperazine |
| SMILES | CN1CCN(c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])CC1.CN1CCNCC1.O=[N+]([O-])c1ccc(F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H14N4O4.C6H3FN2O4.C5H12N2/c1-12-4-6-13(7-5-12)10-3-2-9(14(16)17)8-11(10)15(18)19;7-5-2-1-4(8(10)11)3-6(5)9(12)13;1-7-4-2-6-3-5-7/h2-3,8H,4-7H2,1H3;1-3H;6H,2-5H2,1H3 |
| InChIKey | IUHGEWMBEJFQGQ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 194.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.52 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|