C30H41F3N6O8 — CID 162059221
tert-butyl 4-(4-fluoro-2-nitrophenyl)piperazine-1-carboxylate;tert-butyl piperazine-1-carboxylate;1,4-difluoro-2-nitrobenzene (PubChem CID 162059221) has the molecular formula C30H41F3N6O8 and a molecular weight of 670.69 g/mol. Its IUPAC name is tert-butyl 4-(4-fluoro-2-nitrophenyl)piperazine-1-carboxylate;tert-butyl piperazine-1-carboxylate;1,4-difluoro-2-nitrobenzene.
| Compound Name | tert-butyl 4-(4-fluoro-2-nitrophenyl)piperazine-1-carboxylate;tert-butyl piperazine-1-carboxylate;1,4-difluoro-2-nitrobenzene |
|---|---|
| PubChem CID | 162059221 |
| Molecular Formula | C30H41F3N6O8 |
| Molecular Weight | 670.69 g/mol |
| Exact Mass | 670.29 |
| IUPAC Name | tert-butyl 4-(4-fluoro-2-nitrophenyl)piperazine-1-carboxylate;tert-butyl piperazine-1-carboxylate;1,4-difluoro-2-nitrobenzene |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc(F)cc2[N+](=O)[O-])CC1.CC(C)(C)OC(=O)N1CCNCC1.O=[N+]([O-])c1cc(F)ccc1F |
| InChI | InChI=1S/C15H20FN3O4.C9H18N2O2.C6H3F2NO2/c1-15(2,3)23-14(20)18-8-6-17(7-9-18)12-5-4-11(16)10-13(12)19(21)22;1-9(2,3)13-8(12)11-6-4-10-5-7-11;7-4-1-2-5(8)6(3-4)9(10)11/h4-5,10H,6-9H2,1-3H3;10H,4-7H2,1-3H3;1-3H |
| InChIKey | YZPHBXIAXBUBNF-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 160.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.69 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|