C15H26N4O4 — CID 16748158
tert-butyl 11,12-dioxo-1,4,7,10-tetrazabicyclo[8.2.2]tetradecane-4-carboxylate (PubChem CID 16748158) has the molecular formula C15H26N4O4 and a molecular weight of 326.40 g/mol. Its IUPAC name is tert-butyl 11,12-dioxo-1,4,7,10-tetrazabicyclo[8.2.2]tetradecane-4-carboxylate.
| Compound Name | tert-butyl 11,12-dioxo-1,4,7,10-tetrazabicyclo[8.2.2]tetradecane-4-carboxylate |
|---|---|
| PubChem CID | 16748158 |
| Molecular Formula | C15H26N4O4 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | tert-butyl 11,12-dioxo-1,4,7,10-tetrazabicyclo[8.2.2]tetradecane-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCNCCN2CCN(CC1)C(=O)C2=O |
| InChI | InChI=1S/C15H26N4O4/c1-15(2,3)23-14(22)19-7-5-16-4-6-17-8-9-18(10-11-19)13(21)12(17)20/h16H,4-11H2,1-3H3 |
| InChIKey | QWSHYBMVDXDURV-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|