About tert-butyl piperazine-1-carboxylate;nitroxyl
tert-butyl piperazine-1-carboxylate;nitroxyl (PubChem CID 172741064) has the molecular formula C9H19N3O3
and a molecular weight of 217.27 g/mol. Its IUPAC name is tert-butyl piperazine-1-carboxylate;nitroxyl.
Molecular Properties
| Compound Name | tert-butyl piperazine-1-carboxylate;nitroxyl |
| PubChem CID | 172741064 |
| Molecular Formula | C9H19N3O3 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.14 |
| IUPAC Name | tert-butyl piperazine-1-carboxylate;nitroxyl |
| SMILES | CC(C)(C)OC(=O)N1CCNCC1.N=O |
| InChI | InChI=1S/C9H18N2O2.HNO/c1-9(2,3)13-8(12)11-6-4-10-5-7-11;1-2/h10H,4-7H2,1-3H3;1H |
| InChIKey | JCKWYSQCSPLZSJ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 82.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl piperazine-1-carboxylate;nitroxyl with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl piperazine-1-carboxylate;nitroxyl?
The IUPAC name of tert-butyl piperazine-1-carboxylate;nitroxyl (CID 172741064) is tert-butyl piperazine-1-carboxylate;nitroxyl.
What is the SMILES notation for tert-butyl piperazine-1-carboxylate;nitroxyl?
The canonical SMILES for tert-butyl piperazine-1-carboxylate;nitroxyl is CC(C)(C)OC(=O)N1CCNCC1.N=O.
What is the InChIKey of tert-butyl piperazine-1-carboxylate;nitroxyl?
The InChIKey is JCKWYSQCSPLZSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2O2.HNO/c1-9(2,3)13-8(12)11-6-4-10-5-7-11;1-2/h10H,4-7H2,1-3H3;1H.
What are the key properties of tert-butyl piperazine-1-carboxylate;nitroxyl?
tert-butyl piperazine-1-carboxylate;nitroxyl has a molecular weight of 217.27 g/mol, XLogP of 1.16, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl piperazine-1-carboxylate;nitroxyl is sourced from PubChem (CID 172741064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).