C13H28N4O2 — CID 57428961
tert-butyl 1,4,7,10-tetrazacyclododecane-1-carboxylate (PubChem CID 57428961) has the molecular formula C13H28N4O2 and a molecular weight of 272.39 g/mol. Its IUPAC name is tert-butyl 1,4,7,10-tetrazacyclododecane-1-carboxylate.
| Compound Name | tert-butyl 1,4,7,10-tetrazacyclododecane-1-carboxylate |
|---|---|
| PubChem CID | 57428961 |
| Molecular Formula | C13H28N4O2 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.22 |
| IUPAC Name | tert-butyl 1,4,7,10-tetrazacyclododecane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCNCCNCCNCC1 |
| InChI | InChI=1S/C13H28N4O2/c1-13(2,3)19-12(18)17-10-8-15-6-4-14-5-7-16-9-11-17/h14-16H,4-11H2,1-3H3 |
| InChIKey | TYKLOLACEHJEAB-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |