C14H30N4O2 — CID 159944699
tert-butyl piperazine-1-carboxylate;1-(trideuteriomethyl)piperazine (PubChem CID 159944699) has the molecular formula C14H30N4O2 and a molecular weight of 289.44 g/mol. Its IUPAC name is tert-butyl piperazine-1-carboxylate;1-(trideuteriomethyl)piperazine.
| Compound Name | tert-butyl piperazine-1-carboxylate;1-(trideuteriomethyl)piperazine |
|---|---|
| PubChem CID | 159944699 |
| Molecular Formula | C14H30N4O2 |
| Molecular Weight | 289.44 g/mol |
| Exact Mass | 289.26 |
| IUPAC Name | tert-butyl piperazine-1-carboxylate;1-(trideuteriomethyl)piperazine |
| SMILES | CC(C)(C)OC(=O)N1CCNCC1.[2H]C([2H])([2H])N1CCNCC1 |
| InChI | InChI=1S/C9H18N2O2.C5H12N2/c1-9(2,3)13-8(12)11-6-4-10-5-7-11;1-7-4-2-6-3-5-7/h10H,4-7H2,1-3H3;6H,2-5H2,1H3/i;1D3 |
| InChIKey | OBIKXTDVLFRXGJ-SVLQTQOOSA-N |
| XLogP | 0.35 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.44 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |