About tert-butyl piperazine-1-carboxylate;methane
tert-butyl piperazine-1-carboxylate;methane (PubChem CID 174471990) has the molecular formula C10H22N2O2
and a molecular weight of 202.30 g/mol. Its IUPAC name is tert-butyl piperazine-1-carboxylate;methane.
Molecular Properties
| Compound Name | tert-butyl piperazine-1-carboxylate;methane |
| PubChem CID | 174471990 |
| Molecular Formula | C10H22N2O2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.17 |
| IUPAC Name | tert-butyl piperazine-1-carboxylate;methane |
| SMILES | C.CC(C)(C)OC(=O)N1CCNCC1 |
| InChI | InChI=1S/C9H18N2O2.CH4/c1-9(2,3)13-8(12)11-6-4-10-5-7-11;/h10H,4-7H2,1-3H3;1H4 |
| InChIKey | SFGDLZPOUGHSQD-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl piperazine-1-carboxylate;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl piperazine-1-carboxylate;methane?
The IUPAC name of tert-butyl piperazine-1-carboxylate;methane (CID 174471990) is tert-butyl piperazine-1-carboxylate;methane.
What is the SMILES notation for tert-butyl piperazine-1-carboxylate;methane?
The canonical SMILES for tert-butyl piperazine-1-carboxylate;methane is C.CC(C)(C)OC(=O)N1CCNCC1.
What is the InChIKey of tert-butyl piperazine-1-carboxylate;methane?
The InChIKey is SFGDLZPOUGHSQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2O2.CH4/c1-9(2,3)13-8(12)11-6-4-10-5-7-11;/h10H,4-7H2,1-3H3;1H4.
What are the key properties of tert-butyl piperazine-1-carboxylate;methane?
tert-butyl piperazine-1-carboxylate;methane has a molecular weight of 202.30 g/mol, XLogP of 1.46, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl piperazine-1-carboxylate;methane is sourced from PubChem (CID 174471990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).