C13H28N2O2 — CID 170170212
butane;tert-butyl piperazine-1-carboxylate (PubChem CID 170170212) has the molecular formula C13H28N2O2 and a molecular weight of 244.38 g/mol. Its IUPAC name is butane;tert-butyl piperazine-1-carboxylate.
| Compound Name | butane;tert-butyl piperazine-1-carboxylate |
|---|---|
| PubChem CID | 170170212 |
| Molecular Formula | C13H28N2O2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.22 |
| IUPAC Name | butane;tert-butyl piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCNCC1.CCCC |
| InChI | InChI=1S/C9H18N2O2.C4H10/c1-9(2,3)13-8(12)11-6-4-10-5-7-11;1-3-4-2/h10H,4-7H2,1-3H3;3-4H2,1-2H3 |
| InChIKey | KWMAAFQMBYSHBU-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |