C13H26N2O3 — CID 175464208
(3-hydroxy-2,2-dimethylhexan-3-yl) piperazine-1-carboxylate (PubChem CID 175464208) has the molecular formula C13H26N2O3 and a molecular weight of 258.36 g/mol. Its IUPAC name is (3-hydroxy-2,2-dimethylhexan-3-yl) piperazine-1-carboxylate.
| Compound Name | (3-hydroxy-2,2-dimethylhexan-3-yl) piperazine-1-carboxylate |
|---|---|
| PubChem CID | 175464208 |
| Molecular Formula | C13H26N2O3 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.19 |
| IUPAC Name | (3-hydroxy-2,2-dimethylhexan-3-yl) piperazine-1-carboxylate |
| SMILES | CCCC(O)(OC(=O)N1CCNCC1)C(C)(C)C |
| InChI | InChI=1S/C13H26N2O3/c1-5-6-13(17,12(2,3)4)18-11(16)15-9-7-14-8-10-15/h14,17H,5-10H2,1-4H3 |
| InChIKey | CQZWJGGWUFLOHW-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|