C22H42N4O6 — CID 58918460
4-O,7-O-ditert-butyl 1-O-propan-2-yl 1,4,7,10-tetrazacyclododecane-1,4,7-tricarboxylate (PubChem CID 58918460) has the molecular formula C22H42N4O6 and a molecular weight of 458.60 g/mol. Its IUPAC name is 4-O,7-O-ditert-butyl 1-O-propan-2-yl 1,4,7,10-tetrazacyclododecane-1,4,7-tricarboxylate.
| Compound Name | 4-O,7-O-ditert-butyl 1-O-propan-2-yl 1,4,7,10-tetrazacyclododecane-1,4,7-tricarboxylate |
|---|---|
| PubChem CID | 58918460 |
| Molecular Formula | C22H42N4O6 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.31 |
| IUPAC Name | 4-O,7-O-ditert-butyl 1-O-propan-2-yl 1,4,7,10-tetrazacyclododecane-1,4,7-tricarboxylate |
| SMILES | CC(C)OC(=O)N1CCNCCN(C(=O)OC(C)(C)C)CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C22H42N4O6/c1-17(2)30-18(27)24-11-9-23-10-12-25(19(28)31-21(3,4)5)14-16-26(15-13-24)20(29)32-22(6,7)8/h17,23H,9-16H2,1-8H3 |
| InChIKey | VZIYIQSHPLXCIE-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 100.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|