C14H26N2O6 — CID 142002254
4-O-tert-butyl 1-O-propan-2-yl piperazine-1,4-dicarboxylate;formic acid (PubChem CID 142002254) has the molecular formula C14H26N2O6 and a molecular weight of 318.37 g/mol. Its IUPAC name is 4-O-tert-butyl 1-O-propan-2-yl piperazine-1,4-dicarboxylate;formic acid.
| Compound Name | 4-O-tert-butyl 1-O-propan-2-yl piperazine-1,4-dicarboxylate;formic acid |
|---|---|
| PubChem CID | 142002254 |
| Molecular Formula | C14H26N2O6 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | 4-O-tert-butyl 1-O-propan-2-yl piperazine-1,4-dicarboxylate;formic acid |
| SMILES | CC(C)OC(=O)N1CCN(C(=O)OC(C)(C)C)CC1.O=CO |
| InChI | InChI=1S/C13H24N2O4.CH2O2/c1-10(2)18-11(16)14-6-8-15(9-7-14)12(17)19-13(3,4)5;2-1-3/h10H,6-9H2,1-5H3;1H,(H,2,3) |
| InChIKey | CLXKQPZCDWDVAN-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|