C12H23NO2S — CID 97176087
tert-butyl 4-[(1S)-1-sulfanylethyl]piperidine-1-carboxylate (PubChem CID 97176087) has the molecular formula C12H23NO2S and a molecular weight of 245.39 g/mol. Its IUPAC name is tert-butyl 4-[(1S)-1-sulfanylethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(1S)-1-sulfanylethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 97176087 |
| Molecular Formula | C12H23NO2S |
| Molecular Weight | 245.39 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | tert-butyl 4-[(1S)-1-sulfanylethyl]piperidine-1-carboxylate |
| SMILES | C[C@H](S)C1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C12H23NO2S/c1-9(16)10-5-7-13(8-6-10)11(14)15-12(2,3)4/h9-10,16H,5-8H2,1-4H3/t9-/m0/s1 |
| InChIKey | IRXUDUKFMSMBCX-VIFPVBQESA-N |
| XLogP | 2.95 |
| TPSA | 29.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.39 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|