C18H36N2O2S — CID 142509298
tert-butyl 4-[cyclopropyl-(sulfanylamino)methyl]piperidine-1-carboxylate;2-methylpropane (PubChem CID 142509298) has the molecular formula C18H36N2O2S and a molecular weight of 344.57 g/mol. Its IUPAC name is tert-butyl 4-[cyclopropyl-(sulfanylamino)methyl]piperidine-1-carboxylate;2-methylpropane.
| Compound Name | tert-butyl 4-[cyclopropyl-(sulfanylamino)methyl]piperidine-1-carboxylate;2-methylpropane |
|---|---|
| PubChem CID | 142509298 |
| Molecular Formula | C18H36N2O2S |
| Molecular Weight | 344.57 g/mol |
| Exact Mass | 344.25 |
| IUPAC Name | tert-butyl 4-[cyclopropyl-(sulfanylamino)methyl]piperidine-1-carboxylate;2-methylpropane |
| SMILES | CC(C)(C)OC(=O)N1CCC(C(NS)C2CC2)CC1.CC(C)C |
| InChI | InChI=1S/C14H26N2O2S.C4H10/c1-14(2,3)18-13(17)16-8-6-11(7-9-16)12(15-19)10-4-5-10;1-4(2)3/h10-12,15,19H,4-9H2,1-3H3;4H,1-3H3 |
| InChIKey | CNEIGEISBKNGTB-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.57 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|