C16H33NO3 — CID 155573661
tert-butyl 4-(1-methoxyethyl)piperidine-1-carboxylate;propane (PubChem CID 155573661) has the molecular formula C16H33NO3 and a molecular weight of 287.44 g/mol. Its IUPAC name is tert-butyl 4-(1-methoxyethyl)piperidine-1-carboxylate;propane.
| Compound Name | tert-butyl 4-(1-methoxyethyl)piperidine-1-carboxylate;propane |
|---|---|
| PubChem CID | 155573661 |
| Molecular Formula | C16H33NO3 |
| Molecular Weight | 287.44 g/mol |
| Exact Mass | 287.25 |
| IUPAC Name | tert-butyl 4-(1-methoxyethyl)piperidine-1-carboxylate;propane |
| SMILES | CCC.COC(C)C1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C13H25NO3.C3H8/c1-10(16-5)11-6-8-14(9-7-11)12(15)17-13(2,3)4;1-3-2/h10-11H,6-9H2,1-5H3;3H2,1-2H3 |
| InChIKey | JFFXVFMELBWVIW-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.44 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |