About tert-butyl pyrrolidine-1-carboxylate;difluoromethane;formic acid
tert-butyl pyrrolidine-1-carboxylate;difluoromethane;formic acid (PubChem CID 177206758) has the molecular formula C11H21F2NO4
and a molecular weight of 269.29 g/mol. Its IUPAC name is tert-butyl pyrrolidine-1-carboxylate;difluoromethane;formic acid.
Molecular Properties
| Compound Name | tert-butyl pyrrolidine-1-carboxylate;difluoromethane;formic acid |
| PubChem CID | 177206758 |
| Molecular Formula | C11H21F2NO4 |
| Molecular Weight | 269.29 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | tert-butyl pyrrolidine-1-carboxylate;difluoromethane;formic acid |
| SMILES | CC(C)(C)OC(=O)N1CCCC1.FCF.O=CO |
| InChI | InChI=1S/C9H17NO2.CH2F2.CH2O2/c1-9(2,3)12-8(11)10-6-4-5-7-10;2*2-1-3/h4-7H2,1-3H3;1H2;1H,(H,2,3) |
| InChIKey | FKQSBABOTOHHPM-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.29 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl pyrrolidine-1-carboxylate;difluoromethane;formic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl pyrrolidine-1-carboxylate;difluoromethane;formic acid?
The IUPAC name of tert-butyl pyrrolidine-1-carboxylate;difluoromethane;formic acid (CID 177206758) is tert-butyl pyrrolidine-1-carboxylate;difluoromethane;formic acid.
What is the SMILES notation for tert-butyl pyrrolidine-1-carboxylate;difluoromethane;formic acid?
The canonical SMILES for tert-butyl pyrrolidine-1-carboxylate;difluoromethane;formic acid is CC(C)(C)OC(=O)N1CCCC1.FCF.O=CO.
What is the InChIKey of tert-butyl pyrrolidine-1-carboxylate;difluoromethane;formic acid?
The InChIKey is FKQSBABOTOHHPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO2.CH2F2.CH2O2/c1-9(2,3)12-8(11)10-6-4-5-7-10;2*2-1-3/h4-7H2,1-3H3;1H2;1H,(H,2,3).
What are the key properties of tert-butyl pyrrolidine-1-carboxylate;difluoromethane;formic acid?
tert-butyl pyrrolidine-1-carboxylate;difluoromethane;formic acid has a molecular weight of 269.29 g/mol, XLogP of 2.60, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl pyrrolidine-1-carboxylate;difluoromethane;formic acid is sourced from PubChem (CID 177206758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).