C18H34N2O5 — CID 153347184
tert-butyl piperidine-1-carboxylate;2,2-dimethylpyrrolidine-1-carbaldehyde;formic acid (PubChem CID 153347184) has the molecular formula C18H34N2O5 and a molecular weight of 358.48 g/mol. Its IUPAC name is tert-butyl piperidine-1-carboxylate;2,2-dimethylpyrrolidine-1-carbaldehyde;formic acid.
| Compound Name | tert-butyl piperidine-1-carboxylate;2,2-dimethylpyrrolidine-1-carbaldehyde;formic acid |
|---|---|
| PubChem CID | 153347184 |
| Molecular Formula | C18H34N2O5 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.25 |
| IUPAC Name | tert-butyl piperidine-1-carboxylate;2,2-dimethylpyrrolidine-1-carbaldehyde;formic acid |
| SMILES | CC(C)(C)OC(=O)N1CCCCC1.CC1(C)CCCN1C=O.O=CO |
| InChI | InChI=1S/C10H19NO2.C7H13NO.CH2O2/c1-10(2,3)13-9(12)11-7-5-4-6-8-11;1-7(2)4-3-5-8(7)6-9;2-1-3/h4-8H2,1-3H3;6H,3-5H2,1-2H3;1H,(H,2,3) |
| InChIKey | OAYAOHQVPUWWKO-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|